C25H21N5OS — CID 167675821
10-(1H-isoindol-4-ylmethyl)-7-methyl-4-(1-phenylethyl)-3-thia-5,7,10,11-tetrazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),4,11-tetraen-9-one (PubChem CID 167675821) has the molecular formula C25H21N5OS and a molecular weight of 439.54 g/mol. Its IUPAC name is 10-(1H-isoindol-4-ylmethyl)-7-methyl-4-(1-phenylethyl)-3-thia-5,7,10,11-tetrazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),4,11-tetraen-9-one.
| Compound Name | 10-(1H-isoindol-4-ylmethyl)-7-methyl-4-(1-phenylethyl)-3-thia-5,7,10,11-tetrazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),4,11-tetraen-9-one |
|---|---|
| PubChem CID | 167675821 |
| Molecular Formula | C25H21N5OS |
| Molecular Weight | 439.54 g/mol |
| Exact Mass | 439.15 |
| IUPAC Name | 10-(1H-isoindol-4-ylmethyl)-7-methyl-4-(1-phenylethyl)-3-thia-5,7,10,11-tetrazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),4,11-tetraen-9-one |
| SMILES | CC(c1ccccc1)c1nc2c(s1)c1cnn(Cc3cccc4c3C=NC4)c(=O)c1n2C |
| InChI | InChI=1S/C25H21N5OS/c1-15(16-7-4-3-5-8-16)24-28-23-22(32-24)20-13-27-30(25(31)21(20)29(23)2)14-18-10-6-9-17-11-26-12-19(17)18/h3-10,12-13,15H,11,14H2,1-2H3 |
| InChIKey | QFFMIFYCIFVWIA-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.54 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |