C24H20N6O3S2 — CID 157316579
4-benzylsulfonyl-7-methyl-10-[(1-methylindazol-4-yl)methyl]-3-thia-5,7,10,11-tetrazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),4,11-tetraen-9-one (PubChem CID 157316579) has the molecular formula C24H20N6O3S2 and a molecular weight of 504.60 g/mol. Its IUPAC name is 4-benzylsulfonyl-7-methyl-10-[(1-methylindazol-4-yl)methyl]-3-thia-5,7,10,11-tetrazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),4,11-tetraen-9-one.
| Compound Name | 4-benzylsulfonyl-7-methyl-10-[(1-methylindazol-4-yl)methyl]-3-thia-5,7,10,11-tetrazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),4,11-tetraen-9-one |
|---|---|
| PubChem CID | 157316579 |
| Molecular Formula | C24H20N6O3S2 |
| Molecular Weight | 504.60 g/mol |
| Exact Mass | 504.10 |
| IUPAC Name | 4-benzylsulfonyl-7-methyl-10-[(1-methylindazol-4-yl)methyl]-3-thia-5,7,10,11-tetrazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),4,11-tetraen-9-one |
| SMILES | Cn1ncc2c(Cn3ncc4c5sc(S(=O)(=O)Cc6ccccc6)nc5n(C)c4c3=O)cccc21 |
| InChI | InChI=1S/C24H20N6O3S2/c1-28-20-18(21-22(28)27-24(34-21)35(32,33)14-15-7-4-3-5-8-15)12-26-30(23(20)31)13-16-9-6-10-19-17(16)11-25-29(19)2/h3-12H,13-14H2,1-2H3 |
| InChIKey | DQEQPIBNJZBZIZ-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 104.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.60 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |