C23H29N7O2SSi — CID 150091094
4-(aminomethyl)-7-methyl-10-[[1-(2-trimethylsilylethoxymethyl)indazol-4-yl]methyl]-3-thia-5,7,10,11-tetrazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),4,11-tetraen-9-one (PubChem CID 150091094) has the molecular formula C23H29N7O2SSi and a molecular weight of 495.69 g/mol. Its IUPAC name is 4-(aminomethyl)-7-methyl-10-[[1-(2-trimethylsilylethoxymethyl)indazol-4-yl]methyl]-3-thia-5,7,10,11-tetrazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),4,11-tetraen-9-one.
| Compound Name | 4-(aminomethyl)-7-methyl-10-[[1-(2-trimethylsilylethoxymethyl)indazol-4-yl]methyl]-3-thia-5,7,10,11-tetrazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),4,11-tetraen-9-one |
|---|---|
| PubChem CID | 150091094 |
| Molecular Formula | C23H29N7O2SSi |
| Molecular Weight | 495.69 g/mol |
| Exact Mass | 495.19 |
| IUPAC Name | 4-(aminomethyl)-7-methyl-10-[[1-(2-trimethylsilylethoxymethyl)indazol-4-yl]methyl]-3-thia-5,7,10,11-tetrazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),4,11-tetraen-9-one |
| SMILES | Cn1c2nc(CN)sc2c2cnn(Cc3cccc4c3cnn4COCC[Si](C)(C)C)c(=O)c21 |
| InChI | InChI=1S/C23H29N7O2SSi/c1-28-20-17(21-22(28)27-19(10-24)33-21)12-25-29(23(20)31)13-15-6-5-7-18-16(15)11-26-30(18)14-32-8-9-34(2,3)4/h5-7,11-12H,8-10,13-14,24H2,1-4H3 |
| InChIKey | DTFYLYYUHQGHNG-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 105.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.69 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|