C20H26N10O2SSi — CID 164828818
7-methyl-4-(tetrazol-1-ylmethyl)-10-[[1-(2-trimethylsilylethoxymethyl)pyrazol-3-yl]methyl]-3-thia-5,7,10,11-tetrazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),4,11-tetraen-9-one (PubChem CID 164828818) has the molecular formula C20H26N10O2SSi and a molecular weight of 498.65 g/mol. Its IUPAC name is 7-methyl-4-(tetrazol-1-ylmethyl)-10-[[1-(2-trimethylsilylethoxymethyl)pyrazol-3-yl]methyl]-3-thia-5,7,10,11-tetrazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),4,11-tetraen-9-one.
| Compound Name | 7-methyl-4-(tetrazol-1-ylmethyl)-10-[[1-(2-trimethylsilylethoxymethyl)pyrazol-3-yl]methyl]-3-thia-5,7,10,11-tetrazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),4,11-tetraen-9-one |
|---|---|
| PubChem CID | 164828818 |
| Molecular Formula | C20H26N10O2SSi |
| Molecular Weight | 498.65 g/mol |
| Exact Mass | 498.17 |
| IUPAC Name | 7-methyl-4-(tetrazol-1-ylmethyl)-10-[[1-(2-trimethylsilylethoxymethyl)pyrazol-3-yl]methyl]-3-thia-5,7,10,11-tetrazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),4,11-tetraen-9-one |
| SMILES | Cn1c2nc(Cn3cnnn3)sc2c2cnn(Cc3ccn(COCC[Si](C)(C)C)n3)c(=O)c21 |
| InChI | InChI=1S/C20H26N10O2SSi/c1-27-17-15(18-19(27)23-16(33-18)11-29-12-21-25-26-29)9-22-30(20(17)31)10-14-5-6-28(24-14)13-32-7-8-34(2,3)4/h5-6,9,12H,7-8,10-11,13H2,1-4H3 |
| InChIKey | IMBPEGNPPRTAKI-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 123.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.65 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|