C24H31N7O2SSi — CID 162366921
7-methyl-10-[(1-methylpyrazol-3-yl)methyl]-4-[[1-(2-trimethylsilylethoxymethyl)pyrazol-3-yl]methyl]-3-thia-6,10,11-triazatricyclo[6.4.0.02,6]dodeca-1,4,7,11-tetraen-9-one (PubChem CID 162366921) has the molecular formula C24H31N7O2SSi and a molecular weight of 509.71 g/mol. Its IUPAC name is 7-methyl-10-[(1-methylpyrazol-3-yl)methyl]-4-[[1-(2-trimethylsilylethoxymethyl)pyrazol-3-yl]methyl]-3-thia-6,10,11-triazatricyclo[6.4.0.02,6]dodeca-1,4,7,11-tetraen-9-one.
| Compound Name | 7-methyl-10-[(1-methylpyrazol-3-yl)methyl]-4-[[1-(2-trimethylsilylethoxymethyl)pyrazol-3-yl]methyl]-3-thia-6,10,11-triazatricyclo[6.4.0.02,6]dodeca-1,4,7,11-tetraen-9-one |
|---|---|
| PubChem CID | 162366921 |
| Molecular Formula | C24H31N7O2SSi |
| Molecular Weight | 509.71 g/mol |
| Exact Mass | 509.20 |
| IUPAC Name | 7-methyl-10-[(1-methylpyrazol-3-yl)methyl]-4-[[1-(2-trimethylsilylethoxymethyl)pyrazol-3-yl]methyl]-3-thia-6,10,11-triazatricyclo[6.4.0.02,6]dodeca-1,4,7,11-tetraen-9-one |
| SMILES | Cc1c2c(=O)n(Cc3ccn(C)n3)ncc2c2sc(Cc3ccn(COCC[Si](C)(C)C)n3)cn12 |
| InChI | InChI=1S/C24H31N7O2SSi/c1-17-22-21(13-25-31(23(22)32)14-19-6-8-28(2)26-19)24-30(17)15-20(34-24)12-18-7-9-29(27-18)16-33-10-11-35(3,4)5/h6-9,13,15H,10-12,14,16H2,1-5H3 |
| InChIKey | HPIGCSKTXXWIKT-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 84.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.71 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|