C20H18N8OS2 — CID 174040887
10-[(2-amino-1,3-benzothiazol-4-yl)methyl]-4-(2-amino-4-iminobut-2-enyl)-7-methyl-3-thia-5,7,10,11-tetrazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),4,11-tetraen-9-one (PubChem CID 174040887) has the molecular formula C20H18N8OS2 and a molecular weight of 450.55 g/mol. Its IUPAC name is 10-[(2-amino-1,3-benzothiazol-4-yl)methyl]-4-(2-amino-4-iminobut-2-enyl)-7-methyl-3-thia-5,7,10,11-tetrazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),4,11-tetraen-9-one.
| Compound Name | 10-[(2-amino-1,3-benzothiazol-4-yl)methyl]-4-(2-amino-4-iminobut-2-enyl)-7-methyl-3-thia-5,7,10,11-tetrazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),4,11-tetraen-9-one |
|---|---|
| PubChem CID | 174040887 |
| Molecular Formula | C20H18N8OS2 |
| Molecular Weight | 450.55 g/mol |
| Exact Mass | 450.10 |
| IUPAC Name | 10-[(2-amino-1,3-benzothiazol-4-yl)methyl]-4-(2-amino-4-iminobut-2-enyl)-7-methyl-3-thia-5,7,10,11-tetrazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),4,11-tetraen-9-one |
| SMILES | [H]/N=C/C=C(N)Cc1nc2c(s1)c1cnn(Cc3cccc4sc(N)nc34)c(=O)c1n2C |
| InChI | InChI=1S/C20H18N8OS2/c1-27-16-12(17-18(27)25-14(31-17)7-11(22)5-6-21)8-24-28(19(16)29)9-10-3-2-4-13-15(10)26-20(23)30-13/h2-6,8,21H,7,9,22H2,1H3,(H2,23,26)/b11-5?,21-6+ |
| InChIKey | SAKLYSCRKQHFBY-HWFBNZHKSA-N |
| XLogP | 2.62 |
| TPSA | 141.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.55 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|