C16H19N9OS — CID 166834070
10-[(Z)-2-amino-3-hydrazinylprop-2-enyl]-7-methyl-4-[(1-methylpyrazol-3-yl)methyl]-3-thia-5,7,10,11-tetrazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),4,11-tetraen-9-one (PubChem CID 166834070) has the molecular formula C16H19N9OS and a molecular weight of 385.46 g/mol. Its IUPAC name is 10-[(Z)-2-amino-3-hydrazinylprop-2-enyl]-7-methyl-4-[(1-methylpyrazol-3-yl)methyl]-3-thia-5,7,10,11-tetrazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),4,11-tetraen-9-one.
| Compound Name | 10-[(Z)-2-amino-3-hydrazinylprop-2-enyl]-7-methyl-4-[(1-methylpyrazol-3-yl)methyl]-3-thia-5,7,10,11-tetrazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),4,11-tetraen-9-one |
|---|---|
| PubChem CID | 166834070 |
| Molecular Formula | C16H19N9OS |
| Molecular Weight | 385.46 g/mol |
| Exact Mass | 385.14 |
| IUPAC Name | 10-[(Z)-2-amino-3-hydrazinylprop-2-enyl]-7-methyl-4-[(1-methylpyrazol-3-yl)methyl]-3-thia-5,7,10,11-tetrazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),4,11-tetraen-9-one |
| SMILES | Cn1ccc(Cc2nc3c(s2)c2cnn(C/C(N)=C/NN)c(=O)c2n3C)n1 |
| InChI | InChI=1S/C16H19N9OS/c1-23-4-3-10(22-23)5-12-21-15-14(27-12)11-7-20-25(8-9(17)6-19-18)16(26)13(11)24(15)2/h3-4,6-7,19H,5,8,17-18H2,1-2H3/b9-6- |
| InChIKey | RLUPDAUQQSMKLE-TWGQIWQCSA-N |
| XLogP | -0.07 |
| TPSA | 134.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.46 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|