C18H17F3N8OS — CID 174020805
10-[2-amino-4,4,4-trifluoro-3-(methyliminomethyl)but-2-enyl]-7-methyl-4-(1H-pyrazol-5-ylmethyl)-3-thia-5,7,10,11-tetrazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),4,11-tetraen-9-one (PubChem CID 174020805) has the molecular formula C18H17F3N8OS and a molecular weight of 450.45 g/mol. Its IUPAC name is 10-[2-amino-4,4,4-trifluoro-3-(methyliminomethyl)but-2-enyl]-7-methyl-4-(1H-pyrazol-5-ylmethyl)-3-thia-5,7,10,11-tetrazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),4,11-tetraen-9-one.
| Compound Name | 10-[2-amino-4,4,4-trifluoro-3-(methyliminomethyl)but-2-enyl]-7-methyl-4-(1H-pyrazol-5-ylmethyl)-3-thia-5,7,10,11-tetrazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),4,11-tetraen-9-one |
|---|---|
| PubChem CID | 174020805 |
| Molecular Formula | C18H17F3N8OS |
| Molecular Weight | 450.45 g/mol |
| Exact Mass | 450.12 |
| IUPAC Name | 10-[2-amino-4,4,4-trifluoro-3-(methyliminomethyl)but-2-enyl]-7-methyl-4-(1H-pyrazol-5-ylmethyl)-3-thia-5,7,10,11-tetrazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),4,11-tetraen-9-one |
| SMILES | C/N=C/C(=C(N)Cn1ncc2c3sc(Cc4ccn[nH]4)nc3n(C)c2c1=O)C(F)(F)F |
| InChI | InChI=1S/C18H17F3N8OS/c1-23-7-11(18(19,20)21)12(22)8-29-17(30)14-10(6-25-29)15-16(28(14)2)26-13(31-15)5-9-3-4-24-27-9/h3-4,6-7H,5,8,22H2,1-2H3,(H,24,27)/b12-11?,23-7+ |
| InChIKey | HQUMVRIGWVURNE-KTKKBMHUSA-N |
| XLogP | 2.13 |
| TPSA | 119.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.45 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|