C16H15FN8OS — CID 174040992
10-(2-amino-3-fluoro-4-iminobut-2-enyl)-7-methyl-4-(1H-pyrazol-5-ylmethyl)-3-thia-5,7,10,11-tetrazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),4,11-tetraen-9-one (PubChem CID 174040992) has the molecular formula C16H15FN8OS and a molecular weight of 386.42 g/mol. Its IUPAC name is 10-(2-amino-3-fluoro-4-iminobut-2-enyl)-7-methyl-4-(1H-pyrazol-5-ylmethyl)-3-thia-5,7,10,11-tetrazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),4,11-tetraen-9-one.
| Compound Name | 10-(2-amino-3-fluoro-4-iminobut-2-enyl)-7-methyl-4-(1H-pyrazol-5-ylmethyl)-3-thia-5,7,10,11-tetrazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),4,11-tetraen-9-one |
|---|---|
| PubChem CID | 174040992 |
| Molecular Formula | C16H15FN8OS |
| Molecular Weight | 386.42 g/mol |
| Exact Mass | 386.11 |
| IUPAC Name | 10-(2-amino-3-fluoro-4-iminobut-2-enyl)-7-methyl-4-(1H-pyrazol-5-ylmethyl)-3-thia-5,7,10,11-tetrazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),4,11-tetraen-9-one |
| SMILES | [H]/N=C/C(F)=C(N)Cn1ncc2c3sc(Cc4ccn[nH]4)nc3n(C)c2c1=O |
| InChI | InChI=1S/C16H15FN8OS/c1-24-13-9(6-21-25(16(13)26)7-11(19)10(17)5-18)14-15(24)22-12(27-14)4-8-2-3-20-23-8/h2-3,5-6,18H,4,7,19H2,1H3,(H,20,23)/b11-10?,18-5+ |
| InChIKey | PEPKBRMDZRWUIB-MEMHBOTMSA-N |
| XLogP | 1.45 |
| TPSA | 131.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.42 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|