C17H13N7O2S2 — CID 166834160
4-[[7-methyl-9-oxo-4-(1H-pyrazol-5-ylmethyl)-3-thia-5,7,10,11-tetrazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),4,11-tetraen-10-yl]methyl]-1,3-thiazole-5-carbaldehyde (PubChem CID 166834160) has the molecular formula C17H13N7O2S2 and a molecular weight of 411.47 g/mol. Its IUPAC name is 4-[[7-methyl-9-oxo-4-(1H-pyrazol-5-ylmethyl)-3-thia-5,7,10,11-tetrazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),4,11-tetraen-10-yl]methyl]-1,3-thiazole-5-carbaldehyde.
| Compound Name | 4-[[7-methyl-9-oxo-4-(1H-pyrazol-5-ylmethyl)-3-thia-5,7,10,11-tetrazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),4,11-tetraen-10-yl]methyl]-1,3-thiazole-5-carbaldehyde |
|---|---|
| PubChem CID | 166834160 |
| Molecular Formula | C17H13N7O2S2 |
| Molecular Weight | 411.47 g/mol |
| Exact Mass | 411.06 |
| IUPAC Name | 4-[[7-methyl-9-oxo-4-(1H-pyrazol-5-ylmethyl)-3-thia-5,7,10,11-tetrazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),4,11-tetraen-10-yl]methyl]-1,3-thiazole-5-carbaldehyde |
| SMILES | Cn1c2nc(Cc3ccn[nH]3)sc2c2cnn(Cc3ncsc3C=O)c(=O)c21 |
| InChI | InChI=1S/C17H13N7O2S2/c1-23-14-10(15-16(23)21-13(28-15)4-9-2-3-19-22-9)5-20-24(17(14)26)6-11-12(7-25)27-8-18-11/h2-3,5,7-8H,4,6H2,1H3,(H,19,22) |
| InChIKey | VWTSSUYJNMVOSI-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 111.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.47 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|