C17H15N9OS — CID 174041002
3-amino-2-methanimidoyl-4-[7-methyl-9-oxo-4-(1H-pyrazol-5-ylmethyl)-3-thia-5,7,10,11-tetrazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),4,11-tetraen-10-yl]but-2-enenitrile (PubChem CID 174041002) has the molecular formula C17H15N9OS and a molecular weight of 393.44 g/mol. Its IUPAC name is 3-amino-2-methanimidoyl-4-[7-methyl-9-oxo-4-(1H-pyrazol-5-ylmethyl)-3-thia-5,7,10,11-tetrazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),4,11-tetraen-10-yl]but-2-enenitrile.
| Compound Name | 3-amino-2-methanimidoyl-4-[7-methyl-9-oxo-4-(1H-pyrazol-5-ylmethyl)-3-thia-5,7,10,11-tetrazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),4,11-tetraen-10-yl]but-2-enenitrile |
|---|---|
| PubChem CID | 174041002 |
| Molecular Formula | C17H15N9OS |
| Molecular Weight | 393.44 g/mol |
| Exact Mass | 393.11 |
| IUPAC Name | 3-amino-2-methanimidoyl-4-[7-methyl-9-oxo-4-(1H-pyrazol-5-ylmethyl)-3-thia-5,7,10,11-tetrazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),4,11-tetraen-10-yl]but-2-enenitrile |
| SMILES | [H]/N=C/C(C#N)=C(N)Cn1ncc2c3sc(Cc4ccn[nH]4)nc3n(C)c2c1=O |
| InChI | InChI=1S/C17H15N9OS/c1-25-14-11(7-22-26(17(14)27)8-12(20)9(5-18)6-19)15-16(25)23-13(28-15)4-10-2-3-21-24-10/h2-3,5,7,18H,4,8,20H2,1H3,(H,21,24)/b12-9?,18-5+ |
| InChIKey | VLVLMWPXYAGUIP-CHEQBUAASA-N |
| XLogP | 1.04 |
| TPSA | 155.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.44 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|