C24H19FN4O3 — CID 162683538
7-[(6-fluoro-2-pyridinyl)oxy]-3-[(3-methoxyphenyl)methyl]-5-methylpyridazino[4,5-b]indol-4-one (PubChem CID 162683538) has the molecular formula C24H19FN4O3 and a molecular weight of 430.44 g/mol. Its IUPAC name is 7-[(6-fluoro-2-pyridinyl)oxy]-3-[(3-methoxyphenyl)methyl]-5-methylpyridazino[4,5-b]indol-4-one.
| Compound Name | 7-[(6-fluoro-2-pyridinyl)oxy]-3-[(3-methoxyphenyl)methyl]-5-methylpyridazino[4,5-b]indol-4-one |
|---|---|
| PubChem CID | 162683538 |
| Molecular Formula | C24H19FN4O3 |
| Molecular Weight | 430.44 g/mol |
| Exact Mass | 430.14 |
| IUPAC Name | 7-[(6-fluoro-2-pyridinyl)oxy]-3-[(3-methoxyphenyl)methyl]-5-methylpyridazino[4,5-b]indol-4-one |
| SMILES | COc1cccc(Cn2ncc3c4ccc(Oc5cccc(F)n5)cc4n(C)c3c2=O)c1 |
| InChI | InChI=1S/C24H19FN4O3/c1-28-20-12-17(32-22-8-4-7-21(25)27-22)9-10-18(20)19-13-26-29(24(30)23(19)28)14-15-5-3-6-16(11-15)31-2/h3-13H,14H2,1-2H3 |
| InChIKey | LXTCCHZLSJLVLF-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 71.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.44 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|