C17H14BrN3O2S — CID 44543602
4-bromo-10-[(3-methoxyphenyl)methyl]-7-methyl-3-thia-7,10,11-triazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),4,11-tetraen-9-one (PubChem CID 44543602) has the molecular formula C17H14BrN3O2S and a molecular weight of 404.29 g/mol. Its IUPAC name is 4-bromo-10-[(3-methoxyphenyl)methyl]-7-methyl-3-thia-7,10,11-triazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),4,11-tetraen-9-one.
| Compound Name | 4-bromo-10-[(3-methoxyphenyl)methyl]-7-methyl-3-thia-7,10,11-triazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),4,11-tetraen-9-one |
|---|---|
| PubChem CID | 44543602 |
| Molecular Formula | C17H14BrN3O2S |
| Molecular Weight | 404.29 g/mol |
| Exact Mass | 403.00 |
| IUPAC Name | 4-bromo-10-[(3-methoxyphenyl)methyl]-7-methyl-3-thia-7,10,11-triazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),4,11-tetraen-9-one |
| SMILES | COc1cccc(Cn2ncc3c4sc(Br)cc4n(C)c3c2=O)c1 |
| InChI | InChI=1S/C17H14BrN3O2S/c1-20-13-7-14(18)24-16(13)12-8-19-21(17(22)15(12)20)9-10-4-3-5-11(6-10)23-2/h3-8H,9H2,1-2H3 |
| InChIKey | SPXIMGWYLMAPCS-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 49.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.29 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |