C18H16N4O3S — CID 154681897
10-[(3-methoxyphenyl)methyl]-4-methyl-9-oxo-3-thia-6,10,11-triazatricyclo[6.4.0.02,6]dodeca-1,4,7,11-tetraene-7-carboxamide (PubChem CID 154681897) has the molecular formula C18H16N4O3S and a molecular weight of 368.42 g/mol. Its IUPAC name is 10-[(3-methoxyphenyl)methyl]-4-methyl-9-oxo-3-thia-6,10,11-triazatricyclo[6.4.0.02,6]dodeca-1,4,7,11-tetraene-7-carboxamide.
| Compound Name | 10-[(3-methoxyphenyl)methyl]-4-methyl-9-oxo-3-thia-6,10,11-triazatricyclo[6.4.0.02,6]dodeca-1,4,7,11-tetraene-7-carboxamide |
|---|---|
| PubChem CID | 154681897 |
| Molecular Formula | C18H16N4O3S |
| Molecular Weight | 368.42 g/mol |
| Exact Mass | 368.09 |
| IUPAC Name | 10-[(3-methoxyphenyl)methyl]-4-methyl-9-oxo-3-thia-6,10,11-triazatricyclo[6.4.0.02,6]dodeca-1,4,7,11-tetraene-7-carboxamide |
| SMILES | COc1cccc(Cn2ncc3c(c(C(N)=O)n4cc(C)sc34)c2=O)c1 |
| InChI | InChI=1S/C18H16N4O3S/c1-10-8-21-15(16(19)23)14-13(18(21)26-10)7-20-22(17(14)24)9-11-4-3-5-12(6-11)25-2/h3-8H,9H2,1-2H3,(H2,19,23) |
| InChIKey | UYIJATRBUVEAFR-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 91.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.42 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |