C17H16N4O2S — CID 154681883
10-[(3-methoxyphenyl)methyl]-4,7-dimethyl-3-thia-1,5,10,11-tetrazatricyclo[6.4.0.02,6]dodeca-2(6),4,7,11-tetraen-9-one (PubChem CID 154681883) has the molecular formula C17H16N4O2S and a molecular weight of 340.41 g/mol. Its IUPAC name is 10-[(3-methoxyphenyl)methyl]-4,7-dimethyl-3-thia-1,5,10,11-tetrazatricyclo[6.4.0.02,6]dodeca-2(6),4,7,11-tetraen-9-one.
| Compound Name | 10-[(3-methoxyphenyl)methyl]-4,7-dimethyl-3-thia-1,5,10,11-tetrazatricyclo[6.4.0.02,6]dodeca-2(6),4,7,11-tetraen-9-one |
|---|---|
| PubChem CID | 154681883 |
| Molecular Formula | C17H16N4O2S |
| Molecular Weight | 340.41 g/mol |
| Exact Mass | 340.10 |
| IUPAC Name | 10-[(3-methoxyphenyl)methyl]-4,7-dimethyl-3-thia-1,5,10,11-tetrazatricyclo[6.4.0.02,6]dodeca-2(6),4,7,11-tetraen-9-one |
| SMILES | COc1cccc(Cn2ncn3c(c(C)c4nc(C)sc43)c2=O)c1 |
| InChI | InChI=1S/C17H16N4O2S/c1-10-14-17(24-11(2)19-14)20-9-18-21(16(22)15(10)20)8-12-5-4-6-13(7-12)23-3/h4-7,9H,8H2,1-3H3 |
| InChIKey | JPGDTNNBWNSYDP-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 61.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.41 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |