C22H25N3O4 — CID 162685776
tert-butyl N-[3-[2-(2-methoxyphenyl)ethyl]-4-oxoquinazolin-5-yl]carbamate (PubChem CID 162685776) has the molecular formula C22H25N3O4 and a molecular weight of 395.46 g/mol. Its IUPAC name is tert-butyl N-[3-[2-(2-methoxyphenyl)ethyl]-4-oxoquinazolin-5-yl]carbamate.
| Compound Name | tert-butyl N-[3-[2-(2-methoxyphenyl)ethyl]-4-oxoquinazolin-5-yl]carbamate |
|---|---|
| PubChem CID | 162685776 |
| Molecular Formula | C22H25N3O4 |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.18 |
| IUPAC Name | tert-butyl N-[3-[2-(2-methoxyphenyl)ethyl]-4-oxoquinazolin-5-yl]carbamate |
| SMILES | COc1ccccc1CCn1cnc2cccc(NC(=O)OC(C)(C)C)c2c1=O |
| InChI | InChI=1S/C22H25N3O4/c1-22(2,3)29-21(27)24-17-10-7-9-16-19(17)20(26)25(14-23-16)13-12-15-8-5-6-11-18(15)28-4/h5-11,14H,12-13H2,1-4H3,(H,24,27) |
| InChIKey | HVWDLMSVFJOXDP-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |