About (Z)-N-[(Z)-1-cyanoprop-1-enyl]but-2-enimidoyl cyanide;ethane
(Z)-N-[(Z)-1-cyanoprop-1-enyl]but-2-enimidoyl cyanide;ethane (PubChem CID 162686706) has the molecular formula C11H15N3
and a molecular weight of 189.26 g/mol. Its IUPAC name is (Z)-N-[(Z)-1-cyanoprop-1-enyl]but-2-enimidoyl cyanide;ethane.
Molecular Properties
| Compound Name | (Z)-N-[(Z)-1-cyanoprop-1-enyl]but-2-enimidoyl cyanide;ethane |
| PubChem CID | 162686706 |
| Molecular Formula | C11H15N3 |
| Molecular Weight | 189.26 g/mol |
| Exact Mass | 189.13 |
| IUPAC Name | (Z)-N-[(Z)-1-cyanoprop-1-enyl]but-2-enimidoyl cyanide;ethane |
| SMILES | C/C=C\C(C#N)=N\C(C#N)=C/C.CC |
| InChI | InChI=1S/C9H9N3.C2H6/c1-3-5-9(7-11)12-8(4-2)6-10;1-2/h3-5H,1-2H3;1-2H3/b5-3-,8-4-,12-9-; |
| InChIKey | BMXZSXNPFBTBNT-FONPLPLHSA-N |
| XLogP | 2.98 |
| TPSA | 59.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.26 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (Z)-N-[(Z)-1-cyanoprop-1-enyl]but-2-enimidoyl cyanide;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-N-[(Z)-1-cyanoprop-1-enyl]but-2-enimidoyl cyanide;ethane?
The IUPAC name of (Z)-N-[(Z)-1-cyanoprop-1-enyl]but-2-enimidoyl cyanide;ethane (CID 162686706) is (Z)-N-[(Z)-1-cyanoprop-1-enyl]but-2-enimidoyl cyanide;ethane.
What is the SMILES notation for (Z)-N-[(Z)-1-cyanoprop-1-enyl]but-2-enimidoyl cyanide;ethane?
The canonical SMILES for (Z)-N-[(Z)-1-cyanoprop-1-enyl]but-2-enimidoyl cyanide;ethane is C/C=C\C(C#N)=N\C(C#N)=C/C.CC.
What is the InChIKey of (Z)-N-[(Z)-1-cyanoprop-1-enyl]but-2-enimidoyl cyanide;ethane?
The InChIKey is BMXZSXNPFBTBNT-FONPLPLHSA-N. The full InChI is InChI=1S/C9H9N3.C2H6/c1-3-5-9(7-11)12-8(4-2)6-10;1-2/h3-5H,1-2H3;1-2H3/b5-3-,8-4-,12-9-;.
What are the key properties of (Z)-N-[(Z)-1-cyanoprop-1-enyl]but-2-enimidoyl cyanide;ethane?
(Z)-N-[(Z)-1-cyanoprop-1-enyl]but-2-enimidoyl cyanide;ethane has a molecular weight of 189.26 g/mol, XLogP of 2.98, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-N-[(Z)-1-cyanoprop-1-enyl]but-2-enimidoyl cyanide;ethane is sourced from PubChem (CID 162686706), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).