C19H17F3N4O3 — CID 162687476
tert-butyl N-[4-[2-[3-[(2,2,2-trifluoroacetyl)amino]-2-pyridinyl]ethynyl]-2-pyridinyl]carbamate (PubChem CID 162687476) has the molecular formula C19H17F3N4O3 and a molecular weight of 406.36 g/mol. Its IUPAC name is tert-butyl N-[4-[2-[3-[(2,2,2-trifluoroacetyl)amino]-2-pyridinyl]ethynyl]-2-pyridinyl]carbamate.
| Compound Name | tert-butyl N-[4-[2-[3-[(2,2,2-trifluoroacetyl)amino]-2-pyridinyl]ethynyl]-2-pyridinyl]carbamate |
|---|---|
| PubChem CID | 162687476 |
| Molecular Formula | C19H17F3N4O3 |
| Molecular Weight | 406.36 g/mol |
| Exact Mass | 406.13 |
| IUPAC Name | tert-butyl N-[4-[2-[3-[(2,2,2-trifluoroacetyl)amino]-2-pyridinyl]ethynyl]-2-pyridinyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1cc(C#Cc2ncccc2NC(=O)C(F)(F)F)ccn1 |
| InChI | InChI=1S/C19H17F3N4O3/c1-18(2,3)29-17(28)26-15-11-12(8-10-24-15)6-7-13-14(5-4-9-23-13)25-16(27)19(20,21)22/h4-5,8-11H,1-3H3,(H,25,27)(H,24,26,28) |
| InChIKey | HGIFJIDFABZRTL-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 93.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.36 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|