C17H17N3O3 — CID 53419907
tert-butyl N-[4-[2-(1-oxidopyridin-1-ium-4-yl)ethynyl]-2-pyridinyl]carbamate (PubChem CID 53419907) has the molecular formula C17H17N3O3 and a molecular weight of 311.34 g/mol. Its IUPAC name is tert-butyl N-[4-[2-(1-oxidopyridin-1-ium-4-yl)ethynyl]-2-pyridinyl]carbamate.
| Compound Name | tert-butyl N-[4-[2-(1-oxidopyridin-1-ium-4-yl)ethynyl]-2-pyridinyl]carbamate |
|---|---|
| PubChem CID | 53419907 |
| Molecular Formula | C17H17N3O3 |
| Molecular Weight | 311.34 g/mol |
| Exact Mass | 311.13 |
| IUPAC Name | tert-butyl N-[4-[2-(1-oxidopyridin-1-ium-4-yl)ethynyl]-2-pyridinyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1cc(C#Cc2cc[n+]([O-])cc2)ccn1 |
| InChI | InChI=1S/C17H17N3O3/c1-17(2,3)23-16(21)19-15-12-14(6-9-18-15)5-4-13-7-10-20(22)11-8-13/h6-12H,1-3H3,(H,18,19,21) |
| InChIKey | TYDQIWMTORMRRZ-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 78.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.34 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|