C19H14F3N5O — CID 162687589
4-[7-(2,2-difluoroethoxy)-5-fluoro-3-pyridin-2-yl-1H-pyrrolo[3,2-b]pyridin-2-yl]pyridin-2-amine (PubChem CID 162687589) has the molecular formula C19H14F3N5O and a molecular weight of 385.35 g/mol. Its IUPAC name is 4-[7-(2,2-difluoroethoxy)-5-fluoro-3-pyridin-2-yl-1H-pyrrolo[3,2-b]pyridin-2-yl]pyridin-2-amine.
| Compound Name | 4-[7-(2,2-difluoroethoxy)-5-fluoro-3-pyridin-2-yl-1H-pyrrolo[3,2-b]pyridin-2-yl]pyridin-2-amine |
|---|---|
| PubChem CID | 162687589 |
| Molecular Formula | C19H14F3N5O |
| Molecular Weight | 385.35 g/mol |
| Exact Mass | 385.12 |
| IUPAC Name | 4-[7-(2,2-difluoroethoxy)-5-fluoro-3-pyridin-2-yl-1H-pyrrolo[3,2-b]pyridin-2-yl]pyridin-2-amine |
| SMILES | Nc1cc(-c2[nH]c3c(OCC(F)F)cc(F)nc3c2-c2ccccn2)ccn1 |
| InChI | InChI=1S/C19H14F3N5O/c20-13(21)9-28-12-8-14(22)26-19-16(11-3-1-2-5-24-11)17(27-18(12)19)10-4-6-25-15(23)7-10/h1-8,13,27H,9H2,(H2,23,25) |
| InChIKey | QTQSNYIQIIYDBZ-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 89.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.35 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|