C21H18ClN7O3S — CID 162688246
(3S)-N-[5-(2-chloro-6-methyl-4-pyridinyl)-4-(3-cyanophenyl)-1,3-thiazol-2-yl]-3-nitropiperazine-1-carboxamide (PubChem CID 162688246) has the molecular formula C21H18ClN7O3S and a molecular weight of 483.94 g/mol. Its IUPAC name is (3S)-N-[5-(2-chloro-6-methyl-4-pyridinyl)-4-(3-cyanophenyl)-1,3-thiazol-2-yl]-3-nitropiperazine-1-carboxamide.
| Compound Name | (3S)-N-[5-(2-chloro-6-methyl-4-pyridinyl)-4-(3-cyanophenyl)-1,3-thiazol-2-yl]-3-nitropiperazine-1-carboxamide |
|---|---|
| PubChem CID | 162688246 |
| Molecular Formula | C21H18ClN7O3S |
| Molecular Weight | 483.94 g/mol |
| Exact Mass | 483.09 |
| IUPAC Name | (3S)-N-[5-(2-chloro-6-methyl-4-pyridinyl)-4-(3-cyanophenyl)-1,3-thiazol-2-yl]-3-nitropiperazine-1-carboxamide |
| SMILES | Cc1cc(-c2sc(NC(=O)N3CCN[C@@H]([N+](=O)[O-])C3)nc2-c2cccc(C#N)c2)cc(Cl)n1 |
| InChI | InChI=1S/C21H18ClN7O3S/c1-12-7-15(9-16(22)25-12)19-18(14-4-2-3-13(8-14)10-23)26-20(33-19)27-21(30)28-6-5-24-17(11-28)29(31)32/h2-4,7-9,17,24H,5-6,11H2,1H3,(H,26,27,30)/t17-/m0/s1 |
| InChIKey | RDWNHQGFSORXFT-KRWDZBQOSA-N |
| XLogP | 3.75 |
| TPSA | 137.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.94 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|