C23H29N7O — CID 162689433
4-N-[(2-aminophenyl)methyl]-2-N-[4-(2-pyrrolidin-1-ylethoxy)phenyl]pyrimidine-2,4,5-triamine (PubChem CID 162689433) has the molecular formula C23H29N7O and a molecular weight of 419.53 g/mol. Its IUPAC name is 4-N-[(2-aminophenyl)methyl]-2-N-[4-(2-pyrrolidin-1-ylethoxy)phenyl]pyrimidine-2,4,5-triamine.
| Compound Name | 4-N-[(2-aminophenyl)methyl]-2-N-[4-(2-pyrrolidin-1-ylethoxy)phenyl]pyrimidine-2,4,5-triamine |
|---|---|
| PubChem CID | 162689433 |
| Molecular Formula | C23H29N7O |
| Molecular Weight | 419.53 g/mol |
| Exact Mass | 419.24 |
| IUPAC Name | 4-N-[(2-aminophenyl)methyl]-2-N-[4-(2-pyrrolidin-1-ylethoxy)phenyl]pyrimidine-2,4,5-triamine |
| SMILES | Nc1ccccc1CNc1nc(Nc2ccc(OCCN3CCCC3)cc2)ncc1N |
| InChI | InChI=1S/C23H29N7O/c24-20-6-2-1-5-17(20)15-26-22-21(25)16-27-23(29-22)28-18-7-9-19(10-8-18)31-14-13-30-11-3-4-12-30/h1-2,5-10,16H,3-4,11-15,24-25H2,(H2,26,27,28,29) |
| InChIKey | OEOVZDSMGPXJIA-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 114.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.53 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|