C23H30N8O — CID 162689430
4-N-[(2-aminophenyl)methyl]-2-N-[4-(2-piperazin-1-ylethoxy)phenyl]pyrimidine-2,4,5-triamine (PubChem CID 162689430) has the molecular formula C23H30N8O and a molecular weight of 434.55 g/mol. Its IUPAC name is 4-N-[(2-aminophenyl)methyl]-2-N-[4-(2-piperazin-1-ylethoxy)phenyl]pyrimidine-2,4,5-triamine.
| Compound Name | 4-N-[(2-aminophenyl)methyl]-2-N-[4-(2-piperazin-1-ylethoxy)phenyl]pyrimidine-2,4,5-triamine |
|---|---|
| PubChem CID | 162689430 |
| Molecular Formula | C23H30N8O |
| Molecular Weight | 434.55 g/mol |
| Exact Mass | 434.25 |
| IUPAC Name | 4-N-[(2-aminophenyl)methyl]-2-N-[4-(2-piperazin-1-ylethoxy)phenyl]pyrimidine-2,4,5-triamine |
| SMILES | Nc1ccccc1CNc1nc(Nc2ccc(OCCN3CCNCC3)cc2)ncc1N |
| InChI | InChI=1S/C23H30N8O/c24-20-4-2-1-3-17(20)15-27-22-21(25)16-28-23(30-22)29-18-5-7-19(8-6-18)32-14-13-31-11-9-26-10-12-31/h1-8,16,26H,9-15,24-25H2,(H2,27,28,29,30) |
| InChIKey | ULRKWKBQIPSOMQ-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 126.38 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.55 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|