C23H16F5N3O2 — CID 162689498
3-(difluoromethyl)-1-methyl-N-[7-[(2,3,4-trifluorophenyl)methoxy]naphthalen-1-yl]pyrazole-4-carboxamide (PubChem CID 162689498) has the molecular formula C23H16F5N3O2 and a molecular weight of 461.39 g/mol. Its IUPAC name is 3-(difluoromethyl)-1-methyl-N-[7-[(2,3,4-trifluorophenyl)methoxy]naphthalen-1-yl]pyrazole-4-carboxamide.
| Compound Name | 3-(difluoromethyl)-1-methyl-N-[7-[(2,3,4-trifluorophenyl)methoxy]naphthalen-1-yl]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 162689498 |
| Molecular Formula | C23H16F5N3O2 |
| Molecular Weight | 461.39 g/mol |
| Exact Mass | 461.12 |
| IUPAC Name | 3-(difluoromethyl)-1-methyl-N-[7-[(2,3,4-trifluorophenyl)methoxy]naphthalen-1-yl]pyrazole-4-carboxamide |
| SMILES | Cn1cc(C(=O)Nc2cccc3ccc(OCc4ccc(F)c(F)c4F)cc23)c(C(F)F)n1 |
| InChI | InChI=1S/C23H16F5N3O2/c1-31-10-16(21(30-31)22(27)28)23(32)29-18-4-2-3-12-5-7-14(9-15(12)18)33-11-13-6-8-17(24)20(26)19(13)25/h2-10,22H,11H2,1H3,(H,29,32) |
| InChIKey | RDHHCTSDHLODIA-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.39 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|