C16H29N3O2 — CID 162690079
(2S)-2-[(1,3,5-trimethylpyrazol-4-yl)methylamino]nonanoic acid (PubChem CID 162690079) has the molecular formula C16H29N3O2 and a molecular weight of 295.43 g/mol. Its IUPAC name is (2S)-2-[(1,3,5-trimethylpyrazol-4-yl)methylamino]nonanoic acid.
| Compound Name | (2S)-2-[(1,3,5-trimethylpyrazol-4-yl)methylamino]nonanoic acid |
|---|---|
| PubChem CID | 162690079 |
| Molecular Formula | C16H29N3O2 |
| Molecular Weight | 295.43 g/mol |
| Exact Mass | 295.23 |
| IUPAC Name | (2S)-2-[(1,3,5-trimethylpyrazol-4-yl)methylamino]nonanoic acid |
| SMILES | CCCCCCC[C@H](NCc1c(C)nn(C)c1C)C(=O)O |
| InChI | InChI=1S/C16H29N3O2/c1-5-6-7-8-9-10-15(16(20)21)17-11-14-12(2)18-19(4)13(14)3/h15,17H,5-11H2,1-4H3,(H,20,21)/t15-/m0/s1 |
| InChIKey | MSYHAMHSOYQYFT-HNNXBMFYSA-N |
| XLogP | 2.94 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.43 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|