C12H21N3O2 — CID 79236312
4-[(1,3,5-trimethylpyrazol-4-yl)methylamino]pentanoic acid (PubChem CID 79236312) has the molecular formula C12H21N3O2 and a molecular weight of 239.32 g/mol. Its IUPAC name is 4-[(1,3,5-trimethylpyrazol-4-yl)methylamino]pentanoic acid.
| Compound Name | 4-[(1,3,5-trimethylpyrazol-4-yl)methylamino]pentanoic acid |
|---|---|
| PubChem CID | 79236312 |
| Molecular Formula | C12H21N3O2 |
| Molecular Weight | 239.32 g/mol |
| Exact Mass | 239.16 |
| IUPAC Name | 4-[(1,3,5-trimethylpyrazol-4-yl)methylamino]pentanoic acid |
| SMILES | Cc1nn(C)c(C)c1CNC(C)CCC(=O)O |
| InChI | InChI=1S/C12H21N3O2/c1-8(5-6-12(16)17)13-7-11-9(2)14-15(4)10(11)3/h8,13H,5-7H2,1-4H3,(H,16,17) |
| InChIKey | CGQNPVPNWJMDQB-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.32 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |