C8H11F3N2OS — CID 162690528
(2S,5R)-6-sulfanyl-2-(2,2,2-trifluoroethyl)-1,6-diazabicyclo[3.2.1]octan-7-one (PubChem CID 162690528) has the molecular formula C8H11F3N2OS and a molecular weight of 240.25 g/mol. Its IUPAC name is (2S,5R)-6-sulfanyl-2-(2,2,2-trifluoroethyl)-1,6-diazabicyclo[3.2.1]octan-7-one.
| Compound Name | (2S,5R)-6-sulfanyl-2-(2,2,2-trifluoroethyl)-1,6-diazabicyclo[3.2.1]octan-7-one |
|---|---|
| PubChem CID | 162690528 |
| Molecular Formula | C8H11F3N2OS |
| Molecular Weight | 240.25 g/mol |
| Exact Mass | 240.05 |
| IUPAC Name | (2S,5R)-6-sulfanyl-2-(2,2,2-trifluoroethyl)-1,6-diazabicyclo[3.2.1]octan-7-one |
| SMILES | O=C1N(S)[C@@H]2CC[C@@H](CC(F)(F)F)N1C2 |
| InChI | InChI=1S/C8H11F3N2OS/c9-8(10,11)3-5-1-2-6-4-12(5)7(14)13(6)15/h5-6,15H,1-4H2/t5-,6+/m0/s1 |
| InChIKey | JMRYHHNMKUDSCD-NTSWFWBYSA-N |
| XLogP | 2.05 |
| TPSA | 23.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.25 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|