C33H38N4O6 — CID 162695487
5-(4-methoxy-1H-indole-2-carbonyl)-2-[(2S)-3-oxo-1-[(3S)-2-oxopiperidin-3-yl]-4-phenylmethoxybutan-2-yl]-5-azaspiro[2.4]heptane-6-carboxamide (PubChem CID 162695487) has the molecular formula C33H38N4O6 and a molecular weight of 586.69 g/mol. Its IUPAC name is 5-(4-methoxy-1H-indole-2-carbonyl)-2-[(2S)-3-oxo-1-[(3S)-2-oxopiperidin-3-yl]-4-phenylmethoxybutan-2-yl]-5-azaspiro[2.4]heptane-6-carboxamide.
| Compound Name | 5-(4-methoxy-1H-indole-2-carbonyl)-2-[(2S)-3-oxo-1-[(3S)-2-oxopiperidin-3-yl]-4-phenylmethoxybutan-2-yl]-5-azaspiro[2.4]heptane-6-carboxamide |
|---|---|
| PubChem CID | 162695487 |
| Molecular Formula | C33H38N4O6 |
| Molecular Weight | 586.69 g/mol |
| Exact Mass | 586.28 |
| IUPAC Name | 5-(4-methoxy-1H-indole-2-carbonyl)-2-[(2S)-3-oxo-1-[(3S)-2-oxopiperidin-3-yl]-4-phenylmethoxybutan-2-yl]-5-azaspiro[2.4]heptane-6-carboxamide |
| SMILES | COc1cccc2[nH]c(C(=O)N3CC4(CC3C(N)=O)CC4[C@H](C[C@@H]3CCCNC3=O)C(=O)COCc3ccccc3)cc12 |
| InChI | InChI=1S/C33H38N4O6/c1-42-29-11-5-10-25-23(29)14-26(36-25)32(41)37-19-33(16-27(37)30(34)39)15-24(33)22(13-21-9-6-12-35-31(21)40)28(38)18-43-17-20-7-3-2-4-8-20/h2-5,7-8,10-11,14,21-22,24,27,36H,6,9,12-13,15-19H2,1H3,(H2,34,39)(H,35,40)/t21-,22-,24?,27?,33?/m0/s1 |
| InChIKey | MZJKDTRKYRTVRD-LPTZZOENSA-N |
| XLogP | 3.20 |
| TPSA | 143.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.69 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |