C58H43N4OPtS-3 — CID 162696317
9-[4-(2-phenyl-2-adamantyl)-2-pyridinyl]-2-[[3-(3-phenyl-2H-benzimidazol-2-id-1-yl)-2H-dibenzothiophen-2-id-1-yl]oxy]-1H-carbazol-1-ide;platinum (PubChem CID 162696317) has the molecular formula C58H43N4OPtS-3 and a molecular weight of 1039.15 g/mol. Its IUPAC name is 9-[4-(2-phenyl-2-adamantyl)-2-pyridinyl]-2-[[3-(3-phenyl-2H-benzimidazol-2-id-1-yl)-2H-dibenzothiophen-2-id-1-yl]oxy]-1H-carbazol-1-ide;platinum.
| Compound Name | 9-[4-(2-phenyl-2-adamantyl)-2-pyridinyl]-2-[[3-(3-phenyl-2H-benzimidazol-2-id-1-yl)-2H-dibenzothiophen-2-id-1-yl]oxy]-1H-carbazol-1-ide;platinum |
|---|---|
| PubChem CID | 162696317 |
| Molecular Formula | C58H43N4OPtS-3 |
| Molecular Weight | 1039.15 g/mol |
| Exact Mass | 1038.28 |
| IUPAC Name | 9-[4-(2-phenyl-2-adamantyl)-2-pyridinyl]-2-[[3-(3-phenyl-2H-benzimidazol-2-id-1-yl)-2H-dibenzothiophen-2-id-1-yl]oxy]-1H-carbazol-1-ide;platinum |
| SMILES | [Pt].[c-]1c(N2[CH-]N(c3ccccc3)c3ccccc32)cc2sc3ccccc3c2c1Oc1[c-]c2c(cc1)c1ccccc1n2-c1cc(C2(c3ccccc3)C3CC4CC(C3)CC2C4)ccn1 |
| InChI | InChI=1S/C58H43N4OS.Pt/c1-3-13-39(14-4-1)58(41-28-37-27-38(30-41)31-42(58)29-37)40-25-26-59-56(32-40)62-49-19-9-7-17-46(49)47-24-23-45(35-52(47)62)63-53-33-44(34-55-57(53)48-18-8-12-22-54(48)64-55)61-36-60(43-15-5-2-6-16-43)50-20-10-11-21-51(50)61;/h1-26,32,34,36-38,41-42H,27-31H2;/q-3; |
| InChIKey | IHVFKPKRHGHHAK-UHFFFAOYSA-N |
| XLogP | 15.09 |
| TPSA | 33.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1039.15 |
| LogP ≤ 5 | 15.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|