C45H31N3OSi — CID 162696748
2-(5,5-dimethylbenzo[b][1]benzosilol-1-yl)-4-naphtho[1,2-b][1]benzofuran-7-yl-6-(4-phenylphenyl)-1,3,5-triazine (PubChem CID 162696748) has the molecular formula C45H31N3OSi and a molecular weight of 657.85 g/mol. Its IUPAC name is 2-(5,5-dimethylbenzo[b][1]benzosilol-1-yl)-4-naphtho[1,2-b][1]benzofuran-7-yl-6-(4-phenylphenyl)-1,3,5-triazine.
| Compound Name | 2-(5,5-dimethylbenzo[b][1]benzosilol-1-yl)-4-naphtho[1,2-b][1]benzofuran-7-yl-6-(4-phenylphenyl)-1,3,5-triazine |
|---|---|
| PubChem CID | 162696748 |
| Molecular Formula | C45H31N3OSi |
| Molecular Weight | 657.85 g/mol |
| Exact Mass | 657.22 |
| IUPAC Name | 2-(5,5-dimethylbenzo[b][1]benzosilol-1-yl)-4-naphtho[1,2-b][1]benzofuran-7-yl-6-(4-phenylphenyl)-1,3,5-triazine |
| SMILES | C[Si]1(C)c2ccccc2-c2c(-c3nc(-c4ccc(-c5ccccc5)cc4)nc(-c4cccc5oc6c7ccccc7ccc6c45)n3)cccc21 |
| InChI | InChI=1S/C45H31N3OSi/c1-50(2)38-20-9-8-16-33(38)41-36(18-11-21-39(41)50)45-47-43(31-24-22-29(23-25-31)28-12-4-3-5-13-28)46-44(48-45)35-17-10-19-37-40(35)34-27-26-30-14-6-7-15-32(30)42(34)49-37/h3-27H,1-2H3 |
| InChIKey | HNKAZYUNNDJSCZ-UHFFFAOYSA-N |
| XLogP | 10.40 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.85 |
| LogP ≤ 5 | 10.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|