C13H21N3O4 — CID 162697106
methyl (E)-7-azido-3-(2,2-dimethylpropanoyl)-3-hydroxyhept-5-enoate (PubChem CID 162697106) has the molecular formula C13H21N3O4 and a molecular weight of 283.33 g/mol. Its IUPAC name is methyl (E)-7-azido-3-(2,2-dimethylpropanoyl)-3-hydroxyhept-5-enoate.
| Compound Name | methyl (E)-7-azido-3-(2,2-dimethylpropanoyl)-3-hydroxyhept-5-enoate |
|---|---|
| PubChem CID | 162697106 |
| Molecular Formula | C13H21N3O4 |
| Molecular Weight | 283.33 g/mol |
| Exact Mass | 283.15 |
| IUPAC Name | methyl (E)-7-azido-3-(2,2-dimethylpropanoyl)-3-hydroxyhept-5-enoate |
| SMILES | COC(=O)CC(O)(C/C=C/CN=[N+]=[N-])C(=O)C(C)(C)C |
| InChI | InChI=1S/C13H21N3O4/c1-12(2,3)11(18)13(19,9-10(17)20-4)7-5-6-8-15-16-14/h5-6,19H,7-9H2,1-4H3/b6-5+ |
| InChIKey | RKEPXCWCFLGEMD-AATRIKPKSA-N |
| XLogP | 2.15 |
| TPSA | 112.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.33 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|