C21H27N5 — CID 162702159
N'-[(5-deuterio-1H-benzimidazol-2-yl)methyl]-N'-[(8S)-2,3,4-trideuterio-5,6,7,8-tetrahydroquinolin-8-yl]butane-1,4-diamine (PubChem CID 162702159) has the molecular formula C21H27N5 and a molecular weight of 353.51 g/mol. Its IUPAC name is N'-[(5-deuterio-1H-benzimidazol-2-yl)methyl]-N'-[(8S)-2,3,4-trideuterio-5,6,7,8-tetrahydroquinolin-8-yl]butane-1,4-diamine.
| Compound Name | N'-[(5-deuterio-1H-benzimidazol-2-yl)methyl]-N'-[(8S)-2,3,4-trideuterio-5,6,7,8-tetrahydroquinolin-8-yl]butane-1,4-diamine |
|---|---|
| PubChem CID | 162702159 |
| Molecular Formula | C21H27N5 |
| Molecular Weight | 353.51 g/mol |
| Exact Mass | 353.25 |
| IUPAC Name | N'-[(5-deuterio-1H-benzimidazol-2-yl)methyl]-N'-[(8S)-2,3,4-trideuterio-5,6,7,8-tetrahydroquinolin-8-yl]butane-1,4-diamine |
| SMILES | [2H]c1ccc2[nH]c(CN(CCCCN)[C@H]3CCCc4c3nc([2H])c([2H])c4[2H])nc2c1 |
| InChI | InChI=1S/C21H27N5/c22-12-3-4-14-26(15-20-24-17-9-1-2-10-18(17)25-20)19-11-5-7-16-8-6-13-23-21(16)19/h1-2,6,8-10,13,19H,3-5,7,11-12,14-15,22H2,(H,24,25)/t19-/m0/s1/i1D,6D,8D,13D |
| InChIKey | WVLHHLRVNDMIAR-UTBQFALASA-N |
| XLogP | 3.58 |
| TPSA | 70.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.51 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|