C22H20BClO3 — CID 162703708
2-(3-chloronaphtho[3,2-b][1]benzofuran-11-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 162703708) has the molecular formula C22H20BClO3 and a molecular weight of 378.66 g/mol. Its IUPAC name is 2-(3-chloronaphtho[3,2-b][1]benzofuran-11-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-(3-chloronaphtho[3,2-b][1]benzofuran-11-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 162703708 |
| Molecular Formula | C22H20BClO3 |
| Molecular Weight | 378.66 g/mol |
| Exact Mass | 378.12 |
| IUPAC Name | 2-(3-chloronaphtho[3,2-b][1]benzofuran-11-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | CC1(C)OB(c2c3ccccc3cc3oc4cc(Cl)ccc4c23)OC1(C)C |
| InChI | InChI=1S/C22H20BClO3/c1-21(2)22(3,4)27-23(26-21)20-15-8-6-5-7-13(15)11-18-19(20)16-10-9-14(24)12-17(16)25-18/h5-12H,1-4H3 |
| InChIKey | DFCDFUFXYDHAEZ-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 31.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.66 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|