C60H46GeIrNO — CID 162707324
CID 162707324 (PubChem CID 162707324) has the molecular formula C60H46GeIrNO and a molecular weight of 1066.89 g/mol.
| Compound Name | CID 162707324 |
|---|---|
| PubChem CID | 162707324 |
| Molecular Formula | C60H46GeIrNO |
| Molecular Weight | 1066.89 g/mol |
| Exact Mass | 1068.27 |
| IUPAC Name | — |
| SMILES | [2H]C([2H])([2H])c1cnc(-c2[c-]ccc3c2oc2cc4ccc5ccccc5c4cc23)cc1-c1ccccc1.[2H]C([2H])(c1ccccc1)c1cc(-c2[c-]ccc(-c3ccccc3)c2)[c-]cc1[Ge](C)(C)C.[Ir+3] |
| InChI | InChI=1S/C32H20NO.C28H26Ge.Ir/c1-20-19-33-30(18-27(20)21-8-3-2-4-9-21)26-13-7-12-25-29-17-28-23(16-31(29)34-32(25)26)15-14-22-10-5-6-11-24(22)28;1-29(2,3)28-18-17-26(21-27(28)19-22-11-6-4-7-12-22)25-16-10-15-24(20-25)23-13-8-5-9-14-23;/h2-12,14-19H,1H3;4-15,18,20-21H,19H2,1-3H3;/q-1;-2;+3/i1D3;19D2; |
| InChIKey | QKZRADXCDMQOBP-YVZHUJSLSA-N |
| XLogP | 15.48 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1066.89 |
| LogP ≤ 5 | 15.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|