C24H16FNO — CID 162708001
2-(1-fluorodibenzofuran-4-yl)-4-phenyl-5-(trideuteriomethyl)pyridine (PubChem CID 162708001) has the molecular formula C24H16FNO and a molecular weight of 356.41 g/mol. Its IUPAC name is 2-(1-fluorodibenzofuran-4-yl)-4-phenyl-5-(trideuteriomethyl)pyridine.
| Compound Name | 2-(1-fluorodibenzofuran-4-yl)-4-phenyl-5-(trideuteriomethyl)pyridine |
|---|---|
| PubChem CID | 162708001 |
| Molecular Formula | C24H16FNO |
| Molecular Weight | 356.41 g/mol |
| Exact Mass | 356.14 |
| IUPAC Name | 2-(1-fluorodibenzofuran-4-yl)-4-phenyl-5-(trideuteriomethyl)pyridine |
| SMILES | [2H]C([2H])([2H])c1cnc(-c2ccc(F)c3c2oc2ccccc23)cc1-c1ccccc1 |
| InChI | InChI=1S/C24H16FNO/c1-15-14-26-21(13-19(15)16-7-3-2-4-8-16)17-11-12-20(25)23-18-9-5-6-10-22(18)27-24(17)23/h2-14H,1H3/i1D3 |
| InChIKey | CHSAQFCLUHBCJD-FIBGUPNXSA-N |
| XLogP | 6.76 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.41 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |