C27H23NO — CID 162708909
4-(2-deuteriopropan-2-yl)-2-[9-[dideuterio(phenyl)methyl]dibenzofuran-4-yl]pyridine (PubChem CID 162708909) has the molecular formula C27H23NO and a molecular weight of 380.51 g/mol. Its IUPAC name is 4-(2-deuteriopropan-2-yl)-2-[9-[dideuterio(phenyl)methyl]dibenzofuran-4-yl]pyridine.
| Compound Name | 4-(2-deuteriopropan-2-yl)-2-[9-[dideuterio(phenyl)methyl]dibenzofuran-4-yl]pyridine |
|---|---|
| PubChem CID | 162708909 |
| Molecular Formula | C27H23NO |
| Molecular Weight | 380.51 g/mol |
| Exact Mass | 380.20 |
| IUPAC Name | 4-(2-deuteriopropan-2-yl)-2-[9-[dideuterio(phenyl)methyl]dibenzofuran-4-yl]pyridine |
| SMILES | [2H]C(C)(C)c1ccnc(-c2cccc3c2oc2cccc(C([2H])([2H])c4ccccc4)c23)c1 |
| InChI | InChI=1S/C27H23NO/c1-18(2)20-14-15-28-24(17-20)22-11-7-12-23-26-21(16-19-8-4-3-5-9-19)10-6-13-25(26)29-27(22)23/h3-15,17-18H,16H2,1-2H3/i16D2,18D |
| InChIKey | WAXBVCRBMOQAHW-BQYXMFEKSA-N |
| XLogP | 7.36 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.51 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |