C29H22IrN2-2 — CID 162709590
5-[dideuterio(phenyl)methyl]-2-phenylpyridine;iridium;2-phenylpyridine (PubChem CID 162709590) has the molecular formula C29H22IrN2-2 and a molecular weight of 592.74 g/mol. Its IUPAC name is 5-[dideuterio(phenyl)methyl]-2-phenylpyridine;iridium;2-phenylpyridine.
| Compound Name | 5-[dideuterio(phenyl)methyl]-2-phenylpyridine;iridium;2-phenylpyridine |
|---|---|
| PubChem CID | 162709590 |
| Molecular Formula | C29H22IrN2-2 |
| Molecular Weight | 592.74 g/mol |
| Exact Mass | 593.15 |
| IUPAC Name | 5-[dideuterio(phenyl)methyl]-2-phenylpyridine;iridium;2-phenylpyridine |
| SMILES | [2H]C([2H])(c1ccccc1)c1ccc(-c2[c-]cccc2)nc1.[Ir].[c-]1ccccc1-c1ccccn1 |
| InChI | InChI=1S/C18H14N.C11H8N.Ir/c1-3-7-15(8-4-1)13-16-11-12-18(19-14-16)17-9-5-2-6-10-17;1-2-6-10(7-3-1)11-8-4-5-9-12-11;/h1-9,11-12,14H,13H2;1-6,8-9H;/q2*-1;/i13D2;; |
| InChIKey | QAPFXKKUXMYVKN-DKGKLUEFSA-N |
| XLogP | 6.69 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.74 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|