C14H29NO4PS- — CID 162711103
methyl-[6-[(4-methyl-4-methylsulfanylpentanoyl)amino]hexoxy]phosphinate (PubChem CID 162711103) has the molecular formula C14H29NO4PS- and a molecular weight of 338.43 g/mol. Its IUPAC name is methyl-[6-[(4-methyl-4-methylsulfanylpentanoyl)amino]hexoxy]phosphinate.
| Compound Name | methyl-[6-[(4-methyl-4-methylsulfanylpentanoyl)amino]hexoxy]phosphinate |
|---|---|
| PubChem CID | 162711103 |
| Molecular Formula | C14H29NO4PS- |
| Molecular Weight | 338.43 g/mol |
| Exact Mass | 338.16 |
| IUPAC Name | methyl-[6-[(4-methyl-4-methylsulfanylpentanoyl)amino]hexoxy]phosphinate |
| SMILES | CSC(C)(C)CCC(=O)NCCCCCCOP(C)(=O)[O-] |
| InChI | InChI=1S/C14H30NO4PS/c1-14(2,21-4)10-9-13(16)15-11-7-5-6-8-12-19-20(3,17)18/h5-12H2,1-4H3,(H,15,16)(H,17,18)/p-1 |
| InChIKey | CZTCMBFGCJYJQP-UHFFFAOYSA-M |
| XLogP | 2.78 |
| TPSA | 78.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.43 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|