C18H35NO9 — CID 162711179
N-[(3R,4R,5R,6S)-4,5,6-trihydroxy-2-[2-[2-[2-(3-methylbutoxy)ethoxy]ethoxy]ethoxy]oxan-3-yl]acetamide (PubChem CID 162711179) has the molecular formula C18H35NO9 and a molecular weight of 409.48 g/mol. Its IUPAC name is N-[(3R,4R,5R,6S)-4,5,6-trihydroxy-2-[2-[2-[2-(3-methylbutoxy)ethoxy]ethoxy]ethoxy]oxan-3-yl]acetamide.
| Compound Name | N-[(3R,4R,5R,6S)-4,5,6-trihydroxy-2-[2-[2-[2-(3-methylbutoxy)ethoxy]ethoxy]ethoxy]oxan-3-yl]acetamide |
|---|---|
| PubChem CID | 162711179 |
| Molecular Formula | C18H35NO9 |
| Molecular Weight | 409.48 g/mol |
| Exact Mass | 409.23 |
| IUPAC Name | N-[(3R,4R,5R,6S)-4,5,6-trihydroxy-2-[2-[2-[2-(3-methylbutoxy)ethoxy]ethoxy]ethoxy]oxan-3-yl]acetamide |
| SMILES | CC(=O)N[C@H]1C(OCCOCCOCCOCCC(C)C)O[C@H](O)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C18H35NO9/c1-12(2)4-5-24-6-7-25-8-9-26-10-11-27-18-14(19-13(3)20)15(21)16(22)17(23)28-18/h12,14-18,21-23H,4-11H2,1-3H3,(H,19,20)/t14-,15-,16-,17+,18?/m1/s1 |
| InChIKey | XOJRBGDQIYDMER-VQVIJEGRSA-N |
| XLogP | -1.00 |
| TPSA | 135.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.48 |
| LogP ≤ 5 | -1.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|