C24H15F6IN2O — CID 162713246
2-(3-iodophenyl)-4-[4-(trifluoromethyl)anilino]-1-[4-(trifluoromethyl)phenyl]-2H-pyrrol-5-one (PubChem CID 162713246) has the molecular formula C24H15F6IN2O and a molecular weight of 588.29 g/mol. Its IUPAC name is 2-(3-iodophenyl)-4-[4-(trifluoromethyl)anilino]-1-[4-(trifluoromethyl)phenyl]-2H-pyrrol-5-one.
| Compound Name | 2-(3-iodophenyl)-4-[4-(trifluoromethyl)anilino]-1-[4-(trifluoromethyl)phenyl]-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 162713246 |
| Molecular Formula | C24H15F6IN2O |
| Molecular Weight | 588.29 g/mol |
| Exact Mass | 588.01 |
| IUPAC Name | 2-(3-iodophenyl)-4-[4-(trifluoromethyl)anilino]-1-[4-(trifluoromethyl)phenyl]-2H-pyrrol-5-one |
| SMILES | O=C1C(Nc2ccc(C(F)(F)F)cc2)=CC(c2cccc(I)c2)N1c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C24H15F6IN2O/c25-23(26,27)15-4-8-18(9-5-15)32-20-13-21(14-2-1-3-17(31)12-14)33(22(20)34)19-10-6-16(7-11-19)24(28,29)30/h1-13,21,32H |
| InChIKey | AWLKOFPAVZLJOG-UHFFFAOYSA-N |
| XLogP | 7.41 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.29 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|