C26H24F2N2O2 — CID 7046542
(2R)-2-(4-butoxyphenyl)-4-(4-fluoroanilino)-1-(4-fluorophenyl)-2H-pyrrol-5-one (PubChem CID 7046542) has the molecular formula C26H24F2N2O2 and a molecular weight of 434.49 g/mol. Its IUPAC name is (2R)-2-(4-butoxyphenyl)-4-(4-fluoroanilino)-1-(4-fluorophenyl)-2H-pyrrol-5-one.
| Compound Name | (2R)-2-(4-butoxyphenyl)-4-(4-fluoroanilino)-1-(4-fluorophenyl)-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 7046542 |
| Molecular Formula | C26H24F2N2O2 |
| Molecular Weight | 434.49 g/mol |
| Exact Mass | 434.18 |
| IUPAC Name | (2R)-2-(4-butoxyphenyl)-4-(4-fluoroanilino)-1-(4-fluorophenyl)-2H-pyrrol-5-one |
| SMILES | CCCCOc1ccc([C@H]2C=C(Nc3ccc(F)cc3)C(=O)N2c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C26H24F2N2O2/c1-2-3-16-32-23-14-4-18(5-15-23)25-17-24(29-21-10-6-19(27)7-11-21)26(31)30(25)22-12-8-20(28)9-13-22/h4-15,17,25,29H,2-3,16H2,1H3/t25-/m1/s1 |
| InChIKey | QCHPYXPGHNQSIV-RUZDIDTESA-N |
| XLogP | 6.23 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.49 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|