C30H34N2O2 — CID 7046537
(2S)-2-(4-butoxyphenyl)-4-(4-ethylanilino)-1-(4-ethylphenyl)-2H-pyrrol-5-one (PubChem CID 7046537) has the molecular formula C30H34N2O2 and a molecular weight of 454.61 g/mol. Its IUPAC name is (2S)-2-(4-butoxyphenyl)-4-(4-ethylanilino)-1-(4-ethylphenyl)-2H-pyrrol-5-one.
| Compound Name | (2S)-2-(4-butoxyphenyl)-4-(4-ethylanilino)-1-(4-ethylphenyl)-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 7046537 |
| Molecular Formula | C30H34N2O2 |
| Molecular Weight | 454.61 g/mol |
| Exact Mass | 454.26 |
| IUPAC Name | (2S)-2-(4-butoxyphenyl)-4-(4-ethylanilino)-1-(4-ethylphenyl)-2H-pyrrol-5-one |
| SMILES | CCCCOc1ccc([C@@H]2C=C(Nc3ccc(CC)cc3)C(=O)N2c2ccc(CC)cc2)cc1 |
| InChI | InChI=1S/C30H34N2O2/c1-4-7-20-34-27-18-12-24(13-19-27)29-21-28(31-25-14-8-22(5-2)9-15-25)30(33)32(29)26-16-10-23(6-3)11-17-26/h8-19,21,29,31H,4-7,20H2,1-3H3/t29-/m0/s1 |
| InChIKey | VTLOCMNTFPEVAP-LJAQVGFWSA-N |
| XLogP | 7.07 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.61 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|