C21H22FNO5 — CID 70951984
methyl 4-(4-butoxyphenyl)-3-(4-fluorophenyl)-2-oxo-1,3-oxazolidine-5-carboxylate (PubChem CID 70951984) has the molecular formula C21H22FNO5 and a molecular weight of 387.41 g/mol. Its IUPAC name is methyl 4-(4-butoxyphenyl)-3-(4-fluorophenyl)-2-oxo-1,3-oxazolidine-5-carboxylate.
| Compound Name | methyl 4-(4-butoxyphenyl)-3-(4-fluorophenyl)-2-oxo-1,3-oxazolidine-5-carboxylate |
|---|---|
| PubChem CID | 70951984 |
| Molecular Formula | C21H22FNO5 |
| Molecular Weight | 387.41 g/mol |
| Exact Mass | 387.15 |
| IUPAC Name | methyl 4-(4-butoxyphenyl)-3-(4-fluorophenyl)-2-oxo-1,3-oxazolidine-5-carboxylate |
| SMILES | CCCCOc1ccc(C2C(C(=O)OC)OC(=O)N2c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C21H22FNO5/c1-3-4-13-27-17-11-5-14(6-12-17)18-19(20(24)26-2)28-21(25)23(18)16-9-7-15(22)8-10-16/h5-12,18-19H,3-4,13H2,1-2H3 |
| InChIKey | SJJWBJTWMADBTH-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.41 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|