C15H23NS — CID 162716642
3-(4-tert-butylphenyl)-N,N-dimethylpropanethioamide (PubChem CID 162716642) has the molecular formula C15H23NS and a molecular weight of 249.42 g/mol. Its IUPAC name is 3-(4-tert-butylphenyl)-N,N-dimethylpropanethioamide.
| Compound Name | 3-(4-tert-butylphenyl)-N,N-dimethylpropanethioamide |
|---|---|
| PubChem CID | 162716642 |
| Molecular Formula | C15H23NS |
| Molecular Weight | 249.42 g/mol |
| Exact Mass | 249.16 |
| IUPAC Name | 3-(4-tert-butylphenyl)-N,N-dimethylpropanethioamide |
| SMILES | CN(C)C(=S)CCc1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C15H23NS/c1-15(2,3)13-9-6-12(7-10-13)8-11-14(17)16(4)5/h6-7,9-10H,8,11H2,1-5H3 |
| InChIKey | OVECPQQUYRSRBT-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.42 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|