About methyl 3-(diaminomethylideneamino)-4-methylbenzoate;hydrate;hydrochloride
methyl 3-(diaminomethylideneamino)-4-methylbenzoate;hydrate;hydrochloride (PubChem CID 162718017) has the molecular formula C10H16ClN3O3
and a molecular weight of 261.71 g/mol. Its IUPAC name is methyl 3-(diaminomethylideneamino)-4-methylbenzoate;hydrate;hydrochloride.
Molecular Properties
| Compound Name | methyl 3-(diaminomethylideneamino)-4-methylbenzoate;hydrate;hydrochloride |
| PubChem CID | 162718017 |
| Molecular Formula | C10H16ClN3O3 |
| Molecular Weight | 261.71 g/mol |
| Exact Mass | 261.09 |
| IUPAC Name | methyl 3-(diaminomethylideneamino)-4-methylbenzoate;hydrate;hydrochloride |
| SMILES | COC(=O)c1ccc(C)c(N=C(N)N)c1.Cl.O |
| InChI | InChI=1S/C10H13N3O2.ClH.H2O/c1-6-3-4-7(9(14)15-2)5-8(6)13-10(11)12;;/h3-5H,1-2H3,(H4,11,12,13);1H;1H2 |
| InChIKey | QQEHUECUVLCMOZ-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 122.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.71 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze methyl 3-(diaminomethylideneamino)-4-methylbenzoate;hydrate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-(diaminomethylideneamino)-4-methylbenzoate;hydrate;hydrochloride?
The IUPAC name of methyl 3-(diaminomethylideneamino)-4-methylbenzoate;hydrate;hydrochloride (CID 162718017) is methyl 3-(diaminomethylideneamino)-4-methylbenzoate;hydrate;hydrochloride.
What is the SMILES notation for methyl 3-(diaminomethylideneamino)-4-methylbenzoate;hydrate;hydrochloride?
The canonical SMILES for methyl 3-(diaminomethylideneamino)-4-methylbenzoate;hydrate;hydrochloride is COC(=O)c1ccc(C)c(N=C(N)N)c1.Cl.O.
What is the InChIKey of methyl 3-(diaminomethylideneamino)-4-methylbenzoate;hydrate;hydrochloride?
The InChIKey is QQEHUECUVLCMOZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13N3O2.ClH.H2O/c1-6-3-4-7(9(14)15-2)5-8(6)13-10(11)12;;/h3-5H,1-2H3,(H4,11,12,13);1H;1H2.
What are the key properties of methyl 3-(diaminomethylideneamino)-4-methylbenzoate;hydrate;hydrochloride?
methyl 3-(diaminomethylideneamino)-4-methylbenzoate;hydrate;hydrochloride has a molecular weight of 261.71 g/mol, XLogP of 0.28, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-(diaminomethylideneamino)-4-methylbenzoate;hydrate;hydrochloride is sourced from PubChem (CID 162718017), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).