C28H32N4O3 — CID 162719025
6-[[4-(2-methoxyethoxy)phenyl]methyl]-5-methyl-2-phenyl-3-piperidin-1-yl-1H-pyrazolo[1,5-a]pyrimidin-7-one (PubChem CID 162719025) has the molecular formula C28H32N4O3 and a molecular weight of 472.59 g/mol. Its IUPAC name is 6-[[4-(2-methoxyethoxy)phenyl]methyl]-5-methyl-2-phenyl-3-piperidin-1-yl-1H-pyrazolo[1,5-a]pyrimidin-7-one.
| Compound Name | 6-[[4-(2-methoxyethoxy)phenyl]methyl]-5-methyl-2-phenyl-3-piperidin-1-yl-1H-pyrazolo[1,5-a]pyrimidin-7-one |
|---|---|
| PubChem CID | 162719025 |
| Molecular Formula | C28H32N4O3 |
| Molecular Weight | 472.59 g/mol |
| Exact Mass | 472.25 |
| IUPAC Name | 6-[[4-(2-methoxyethoxy)phenyl]methyl]-5-methyl-2-phenyl-3-piperidin-1-yl-1H-pyrazolo[1,5-a]pyrimidin-7-one |
| SMILES | COCCOc1ccc(Cc2c(C)nc3c(N4CCCCC4)c(-c4ccccc4)[nH]n3c2=O)cc1 |
| InChI | InChI=1S/C28H32N4O3/c1-20-24(19-21-11-13-23(14-12-21)35-18-17-34-2)28(33)32-27(29-20)26(31-15-7-4-8-16-31)25(30-32)22-9-5-3-6-10-22/h3,5-6,9-14,30H,4,7-8,15-19H2,1-2H3 |
| InChIKey | BYQGDCFGPHROAD-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 71.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.59 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|