C20H26N4O2 — CID 82273394
3-[(dimethylamino)methyl]-2,5-dimethyl-6-(3-phenoxypropyl)-1H-pyrazolo[1,5-a]pyrimidin-7-one (PubChem CID 82273394) has the molecular formula C20H26N4O2 and a molecular weight of 354.45 g/mol. Its IUPAC name is 3-[(dimethylamino)methyl]-2,5-dimethyl-6-(3-phenoxypropyl)-1H-pyrazolo[1,5-a]pyrimidin-7-one.
| Compound Name | 3-[(dimethylamino)methyl]-2,5-dimethyl-6-(3-phenoxypropyl)-1H-pyrazolo[1,5-a]pyrimidin-7-one |
|---|---|
| PubChem CID | 82273394 |
| Molecular Formula | C20H26N4O2 |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.21 |
| IUPAC Name | 3-[(dimethylamino)methyl]-2,5-dimethyl-6-(3-phenoxypropyl)-1H-pyrazolo[1,5-a]pyrimidin-7-one |
| SMILES | Cc1nc2c(CN(C)C)c(C)[nH]n2c(=O)c1CCCOc1ccccc1 |
| InChI | InChI=1S/C20H26N4O2/c1-14-17(11-8-12-26-16-9-6-5-7-10-16)20(25)24-19(21-14)18(13-23(3)4)15(2)22-24/h5-7,9-10,22H,8,11-13H2,1-4H3 |
| InChIKey | DUHIDQSNIRJXRM-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 62.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|