3-[2-[2-(2,5-dioxopyrrol-1-yl)ethyl]hydrazinyl]propanoic acid

C9H13N3O4 — CID 162720754

IUPAC3-[2-[2-(2,5-dioxopyrrol-1-yl)ethyl]hydrazinyl]propanoic acid
SMILESO=C(O)CCNNCCN1C(=O)C=CC1=O
InChIInChI=1S/C9H13N3O4/c13-7-1-2-8(14)12(7)6-5-11-10-4-3-9(15)16/h1-2,10-11H,3-6H2,(H,15,16)
InChIKeyIFFWNXLDRBCAIL-UHFFFAOYSA-N
MW227.22 g/mol
LogP-1.52
Rot. Bonds7

About 3-[2-[2-(2,5-dioxopyrrol-1-yl)ethyl]hydrazinyl]propanoic acid

3-[2-[2-(2,5-dioxopyrrol-1-yl)ethyl]hydrazinyl]propanoic acid (PubChem CID 162720754) has the molecular formula C9H13N3O4 and a molecular weight of 227.22 g/mol. Its IUPAC name is 3-[2-[2-(2,5-dioxopyrrol-1-yl)ethyl]hydrazinyl]propanoic acid.

Molecular Properties

Compound Name3-[2-[2-(2,5-dioxopyrrol-1-yl)ethyl]hydrazinyl]propanoic acid
PubChem CID162720754
Molecular FormulaC9H13N3O4
Molecular Weight227.22 g/mol
Exact Mass227.09
IUPAC Name3-[2-[2-(2,5-dioxopyrrol-1-yl)ethyl]hydrazinyl]propanoic acid
SMILESO=C(O)CCNNCCN1C(=O)C=CC1=O
InChIInChI=1S/C9H13N3O4/c13-7-1-2-8(14)12(7)6-5-11-10-4-3-9(15)16/h1-2,10-11H,3-6H2,(H,15,16)
InChIKeyIFFWNXLDRBCAIL-UHFFFAOYSA-N
XLogP-1.52
TPSA98.74 Ų
H-Bond Donors3
H-Bond Acceptors5
Rotatable Bonds7
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500227.22
LogP ≤ 5-1.52
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}

Analyze 3-[2-[2-(2,5-dioxopyrrol-1-yl)ethyl]hydrazinyl]propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-[2-[2-(2,5-dioxopyrrol-1-yl)ethyl]hydrazinyl]propanoic acid?
The IUPAC name of 3-[2-[2-(2,5-dioxopyrrol-1-yl)ethyl]hydrazinyl]propanoic acid (CID 162720754) is 3-[2-[2-(2,5-dioxopyrrol-1-yl)ethyl]hydrazinyl]propanoic acid.
What is the SMILES notation for 3-[2-[2-(2,5-dioxopyrrol-1-yl)ethyl]hydrazinyl]propanoic acid?
The canonical SMILES for 3-[2-[2-(2,5-dioxopyrrol-1-yl)ethyl]hydrazinyl]propanoic acid is O=C(O)CCNNCCN1C(=O)C=CC1=O.
What is the InChIKey of 3-[2-[2-(2,5-dioxopyrrol-1-yl)ethyl]hydrazinyl]propanoic acid?
The InChIKey is IFFWNXLDRBCAIL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13N3O4/c13-7-1-2-8(14)12(7)6-5-11-10-4-3-9(15)16/h1-2,10-11H,3-6H2,(H,15,16).
What are the key properties of 3-[2-[2-(2,5-dioxopyrrol-1-yl)ethyl]hydrazinyl]propanoic acid?
3-[2-[2-(2,5-dioxopyrrol-1-yl)ethyl]hydrazinyl]propanoic acid has a molecular weight of 227.22 g/mol, XLogP of -1.52, 7 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-[2-(2,5-dioxopyrrol-1-yl)ethyl]hydrazinyl]propanoic acid is sourced from PubChem (CID 162720754), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).