C9H13N3O4 — CID 162720754
3-[2-[2-(2,5-dioxopyrrol-1-yl)ethyl]hydrazinyl]propanoic acid (PubChem CID 162720754) has the molecular formula C9H13N3O4 and a molecular weight of 227.22 g/mol. Its IUPAC name is 3-[2-[2-(2,5-dioxopyrrol-1-yl)ethyl]hydrazinyl]propanoic acid.
| Compound Name | 3-[2-[2-(2,5-dioxopyrrol-1-yl)ethyl]hydrazinyl]propanoic acid |
|---|---|
| PubChem CID | 162720754 |
| Molecular Formula | C9H13N3O4 |
| Molecular Weight | 227.22 g/mol |
| Exact Mass | 227.09 |
| IUPAC Name | 3-[2-[2-(2,5-dioxopyrrol-1-yl)ethyl]hydrazinyl]propanoic acid |
| SMILES | O=C(O)CCNNCCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C9H13N3O4/c13-7-1-2-8(14)12(7)6-5-11-10-4-3-9(15)16/h1-2,10-11H,3-6H2,(H,15,16) |
| InChIKey | IFFWNXLDRBCAIL-UHFFFAOYSA-N |
| XLogP | -1.52 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.22 |
| LogP ≤ 5 | -1.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|