C23H28N2O2 — CID 162723386
ethane;1-(5-ethyl-4-methyl-3-oxa-4,13-diazatetracyclo[13.4.0.02,6.07,12]nonadeca-1(19),2(6),7,9,11,15,17-heptaen-13-yl)ethanone (PubChem CID 162723386) has the molecular formula C23H28N2O2 and a molecular weight of 364.49 g/mol. Its IUPAC name is ethane;1-(5-ethyl-4-methyl-3-oxa-4,13-diazatetracyclo[13.4.0.02,6.07,12]nonadeca-1(19),2(6),7,9,11,15,17-heptaen-13-yl)ethanone.
| Compound Name | ethane;1-(5-ethyl-4-methyl-3-oxa-4,13-diazatetracyclo[13.4.0.02,6.07,12]nonadeca-1(19),2(6),7,9,11,15,17-heptaen-13-yl)ethanone |
|---|---|
| PubChem CID | 162723386 |
| Molecular Formula | C23H28N2O2 |
| Molecular Weight | 364.49 g/mol |
| Exact Mass | 364.22 |
| IUPAC Name | ethane;1-(5-ethyl-4-methyl-3-oxa-4,13-diazatetracyclo[13.4.0.02,6.07,12]nonadeca-1(19),2(6),7,9,11,15,17-heptaen-13-yl)ethanone |
| SMILES | CC.CCC1C2=C(ON1C)c1ccccc1CN(C(C)=O)c1ccccc12 |
| InChI | InChI=1S/C21H22N2O2.C2H6/c1-4-18-20-17-11-7-8-12-19(17)23(14(2)24)13-15-9-5-6-10-16(15)21(20)25-22(18)3;1-2/h5-12,18H,4,13H2,1-3H3;1-2H3 |
| InChIKey | LFELRLVNVDOTEE-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.49 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|