About ethane;4-ethyl-2-methylhexane;toluene
ethane;4-ethyl-2-methylhexane;toluene (PubChem CID 162724612) has the molecular formula C18H34
and a molecular weight of 250.47 g/mol. Its IUPAC name is ethane;4-ethyl-2-methylhexane;toluene.
Molecular Properties
| Compound Name | ethane;4-ethyl-2-methylhexane;toluene |
| PubChem CID | 162724612 |
| Molecular Formula | C18H34 |
| Molecular Weight | 250.47 g/mol |
| Exact Mass | 250.27 |
| IUPAC Name | ethane;4-ethyl-2-methylhexane;toluene |
| SMILES | CC.CCC(CC)CC(C)C.Cc1ccccc1 |
| InChI | InChI=1S/C9H20.C7H8.C2H6/c1-5-9(6-2)7-8(3)4;1-7-5-3-2-4-6-7;1-2/h8-9H,5-7H2,1-4H3;2-6H,1H3;1-2H3 |
| InChIKey | QLPZGRFREJGHDY-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 250.47 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze ethane;4-ethyl-2-methylhexane;toluene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;4-ethyl-2-methylhexane;toluene?
The IUPAC name of ethane;4-ethyl-2-methylhexane;toluene (CID 162724612) is ethane;4-ethyl-2-methylhexane;toluene.
What is the SMILES notation for ethane;4-ethyl-2-methylhexane;toluene?
The canonical SMILES for ethane;4-ethyl-2-methylhexane;toluene is CC.CCC(CC)CC(C)C.Cc1ccccc1.
What is the InChIKey of ethane;4-ethyl-2-methylhexane;toluene?
The InChIKey is QLPZGRFREJGHDY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H20.C7H8.C2H6/c1-5-9(6-2)7-8(3)4;1-7-5-3-2-4-6-7;1-2/h8-9H,5-7H2,1-4H3;2-6H,1H3;1-2H3.
What are the key properties of ethane;4-ethyl-2-methylhexane;toluene?
ethane;4-ethyl-2-methylhexane;toluene has a molecular weight of 250.47 g/mol, XLogP of 6.49, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;4-ethyl-2-methylhexane;toluene is sourced from PubChem (CID 162724612), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).